C16H20N2O5S — CID 110666980
N-cyclopentyloxy-4-(2,6-dioxopiperidin-1-yl)benzenesulfonamide (PubChem CID 110666980) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is N-cyclopentyloxy-4-(2,6-dioxopiperidin-1-yl)benzenesulfonamide.
| Compound Name | N-cyclopentyloxy-4-(2,6-dioxopiperidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110666980 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N-cyclopentyloxy-4-(2,6-dioxopiperidin-1-yl)benzenesulfonamide |
| SMILES | O=C1CCCC(=O)N1c1ccc(S(=O)(=O)NOC2CCCC2)cc1 |
| InChI | InChI=1S/C16H20N2O5S/c19-15-6-3-7-16(20)18(15)12-8-10-14(11-9-12)24(21,22)17-23-13-4-1-2-5-13/h8-11,13,17H,1-7H2 |
| InChIKey | AUASCOGGGGITNJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|