C18H28N2O4 — CID 110669082
tert-butyl N-[1-[(2-methoxybenzoyl)-methylamino]-2-methylpropan-2-yl]carbamate (PubChem CID 110669082) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is tert-butyl N-[1-[(2-methoxybenzoyl)-methylamino]-2-methylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(2-methoxybenzoyl)-methylamino]-2-methylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 110669082 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | tert-butyl N-[1-[(2-methoxybenzoyl)-methylamino]-2-methylpropan-2-yl]carbamate |
| SMILES | COc1ccccc1C(=O)N(C)CC(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N2O4/c1-17(2,3)24-16(22)19-18(4,5)12-20(6)15(21)13-10-8-9-11-14(13)23-7/h8-11H,12H2,1-7H3,(H,19,22) |
| InChIKey | JDNMDRKWBXCWCO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |