C16H12F3NO3 — CID 110670433
(3-methylphenyl) 2-[(2,3,4-trifluorobenzoyl)amino]acetate (PubChem CID 110670433) has the molecular formula C16H12F3NO3 and a molecular weight of 323.27 g/mol. Its IUPAC name is (3-methylphenyl) 2-[(2,3,4-trifluorobenzoyl)amino]acetate.
| Compound Name | (3-methylphenyl) 2-[(2,3,4-trifluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 110670433 |
| Molecular Formula | C16H12F3NO3 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (3-methylphenyl) 2-[(2,3,4-trifluorobenzoyl)amino]acetate |
| SMILES | Cc1cccc(OC(=O)CNC(=O)c2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C16H12F3NO3/c1-9-3-2-4-10(7-9)23-13(21)8-20-16(22)11-5-6-12(17)15(19)14(11)18/h2-7H,8H2,1H3,(H,20,22) |
| InChIKey | VWRMFADJCCFKER-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|