C18H18FNO3 — CID 110670442
(3-methylphenyl) 2-[3-(4-fluorophenyl)propanoylamino]acetate (PubChem CID 110670442) has the molecular formula C18H18FNO3 and a molecular weight of 315.34 g/mol. Its IUPAC name is (3-methylphenyl) 2-[3-(4-fluorophenyl)propanoylamino]acetate.
| Compound Name | (3-methylphenyl) 2-[3-(4-fluorophenyl)propanoylamino]acetate |
|---|---|
| PubChem CID | 110670442 |
| Molecular Formula | C18H18FNO3 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (3-methylphenyl) 2-[3-(4-fluorophenyl)propanoylamino]acetate |
| SMILES | Cc1cccc(OC(=O)CNC(=O)CCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H18FNO3/c1-13-3-2-4-16(11-13)23-18(22)12-20-17(21)10-7-14-5-8-15(19)9-6-14/h2-6,8-9,11H,7,10,12H2,1H3,(H,20,21) |
| InChIKey | VIAYONQFIXJUOB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|