C19H19FN2O5 — CID 8911027
[2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-(3-methylphenoxy)acetate (PubChem CID 8911027) has the molecular formula C19H19FN2O5 and a molecular weight of 374.37 g/mol. Its IUPAC name is [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-(3-methylphenoxy)acetate.
| Compound Name | [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-(3-methylphenoxy)acetate |
|---|---|
| PubChem CID | 8911027 |
| Molecular Formula | C19H19FN2O5 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-(3-methylphenoxy)acetate |
| SMILES | Cc1cccc(OCC(=O)OCC(=O)NCC(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H19FN2O5/c1-13-3-2-4-16(9-13)26-12-19(25)27-11-18(24)21-10-17(23)22-15-7-5-14(20)6-8-15/h2-9H,10-12H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | ZOAIETQAGIISEN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |