C20H20N2O2 — CID 110671190
N-[(4-methyl-1,3-oxazol-5-yl)methyl]-3,3-diphenylpropanamide (PubChem CID 110671190) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[(4-methyl-1,3-oxazol-5-yl)methyl]-3,3-diphenylpropanamide.
| Compound Name | N-[(4-methyl-1,3-oxazol-5-yl)methyl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 110671190 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-[(4-methyl-1,3-oxazol-5-yl)methyl]-3,3-diphenylpropanamide |
| SMILES | Cc1ncoc1CNC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O2/c1-15-19(24-14-22-15)13-21-20(23)12-18(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,14,18H,12-13H2,1H3,(H,21,23) |
| InChIKey | QJNULTZGGUJLMZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |