C17H13F4NO3 — CID 110671680
4-(4-fluorophenyl)-4-[(2,3,4-trifluorobenzoyl)amino]butanoic acid (PubChem CID 110671680) has the molecular formula C17H13F4NO3 and a molecular weight of 355.29 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-4-[(2,3,4-trifluorobenzoyl)amino]butanoic acid.
| Compound Name | 4-(4-fluorophenyl)-4-[(2,3,4-trifluorobenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 110671680 |
| Molecular Formula | C17H13F4NO3 |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 4-(4-fluorophenyl)-4-[(2,3,4-trifluorobenzoyl)amino]butanoic acid |
| SMILES | O=C(O)CCC(NC(=O)c1ccc(F)c(F)c1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H13F4NO3/c18-10-3-1-9(2-4-10)13(7-8-14(23)24)22-17(25)11-5-6-12(19)16(21)15(11)20/h1-6,13H,7-8H2,(H,22,25)(H,23,24) |
| InChIKey | YZCPKOBEFFWRND-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|