C18H31NO4 — CID 11067345
tert-butyl 2-[(E)-1-ethoxy-5-methyl-1-oxohex-3-en-3-yl]pyrrolidine-1-carboxylate (PubChem CID 11067345) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is tert-butyl 2-[(E)-1-ethoxy-5-methyl-1-oxohex-3-en-3-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(E)-1-ethoxy-5-methyl-1-oxohex-3-en-3-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11067345 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | tert-butyl 2-[(E)-1-ethoxy-5-methyl-1-oxohex-3-en-3-yl]pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)C/C(=C\C(C)C)C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31NO4/c1-7-22-16(20)12-14(11-13(2)3)15-9-8-10-19(15)17(21)23-18(4,5)6/h11,13,15H,7-10,12H2,1-6H3/b14-11+ |
| InChIKey | SRFGGGWEGARYSS-SDNWHVSQSA-N |
| XLogP | 3.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|