C19H33NO4 — CID 10712140
tert-butyl 2-[(E)-1-ethoxy-5-methyl-1-oxohex-3-en-3-yl]piperidine-1-carboxylate (PubChem CID 10712140) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is tert-butyl 2-[(E)-1-ethoxy-5-methyl-1-oxohex-3-en-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(E)-1-ethoxy-5-methyl-1-oxohex-3-en-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10712140 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | tert-butyl 2-[(E)-1-ethoxy-5-methyl-1-oxohex-3-en-3-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)C/C(=C\C(C)C)C1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H33NO4/c1-7-23-17(21)13-15(12-14(2)3)16-10-8-9-11-20(16)18(22)24-19(4,5)6/h12,14,16H,7-11,13H2,1-6H3/b15-12+ |
| InChIKey | PZLGHPKSSABXTD-NTCAYCPXSA-N |
| XLogP | 4.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|