C18H22N6O3 — CID 110673460
N-[2-[4-(4-methylpiperazin-1-yl)anilino]-2-oxoethyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 110673460) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-[2-[4-(4-methylpiperazin-1-yl)anilino]-2-oxoethyl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[2-[4-(4-methylpiperazin-1-yl)anilino]-2-oxoethyl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 110673460 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-[2-[4-(4-methylpiperazin-1-yl)anilino]-2-oxoethyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)CNC(=O)c3ccc(=O)[nH]n3)cc2)CC1 |
| InChI | InChI=1S/C18H22N6O3/c1-23-8-10-24(11-9-23)14-4-2-13(3-5-14)20-17(26)12-19-18(27)15-6-7-16(25)22-21-15/h2-7H,8-12H2,1H3,(H,19,27)(H,20,26)(H,22,25) |
| InChIKey | JVGGSYINSOTGEY-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|