C17H21N5O3 — CID 110700131
2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide (PubChem CID 110700131) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 110700131 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CN1CCN(c2ccc(NC(=O)Cc3cc(=O)[nH]c(=O)[nH]3)cc2)CC1 |
| InChI | InChI=1S/C17H21N5O3/c1-21-6-8-22(9-7-21)14-4-2-12(3-5-14)18-15(23)10-13-11-16(24)20-17(25)19-13/h2-5,11H,6-10H2,1H3,(H,18,23)(H2,19,20,24,25) |
| InChIKey | UQROZWHPZDVHRT-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|