C16H18N4O3 — CID 110700033
6-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1H-pyrimidine-2,4-dione (PubChem CID 110700033) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is 6-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 110700033 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 6-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=C(Cc1cc(=O)[nH]c(=O)[nH]1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C16H18N4O3/c21-14-10-12(17-16(23)18-14)11-15(22)20-8-6-19(7-9-20)13-4-2-1-3-5-13/h1-5,10H,6-9,11H2,(H2,17,18,21,23) |
| InChIKey | MMXCJVASSCJLAP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |