C10H20N2O2 — CID 110675943
N-(methoxymethyl)-2,6-dimethylpiperidine-1-carboxamide (PubChem CID 110675943) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is N-(methoxymethyl)-2,6-dimethylpiperidine-1-carboxamide.
| Compound Name | N-(methoxymethyl)-2,6-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 110675943 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | N-(methoxymethyl)-2,6-dimethylpiperidine-1-carboxamide |
| SMILES | COCNC(=O)N1C(C)CCCC1C |
| InChI | InChI=1S/C10H20N2O2/c1-8-5-4-6-9(2)12(8)10(13)11-7-14-3/h8-9H,4-7H2,1-3H3,(H,11,13) |
| InChIKey | YXTKWTROQLFBGM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|