2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate

C11H21NO3 — CID 142740059

IUPAC2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate
SMILESCOCCOC(=O)N1C(C)CCCC1C
InChIInChI=1S/C11H21NO3/c1-9-5-4-6-10(2)12(9)11(13)15-8-7-14-3/h9-10H,4-8H2,1-3H3
InChIKeyWEAMNROVCOIRJY-UHFFFAOYSA-N
MW215.29 g/mol
LogP2.03
Rot. Bonds3

About 2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate

2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate (PubChem CID 142740059) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate.

Molecular Properties

Compound Name2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate
PubChem CID142740059
Molecular FormulaC11H21NO3
Molecular Weight215.29 g/mol
Exact Mass215.15
IUPAC Name2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate
SMILESCOCCOC(=O)N1C(C)CCCC1C
InChIInChI=1S/C11H21NO3/c1-9-5-4-6-10(2)12(9)11(13)15-8-7-14-3/h9-10H,4-8H2,1-3H3
InChIKeyWEAMNROVCOIRJY-UHFFFAOYSA-N
XLogP2.03
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.29
LogP ≤ 52.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate?
The IUPAC name of 2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate (CID 142740059) is 2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate.
What is the SMILES notation for 2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate?
The canonical SMILES for 2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate is COCCOC(=O)N1C(C)CCCC1C.
What is the InChIKey of 2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate?
The InChIKey is WEAMNROVCOIRJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-9-5-4-6-10(2)12(9)11(13)15-8-7-14-3/h9-10H,4-8H2,1-3H3.
What are the key properties of 2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate?
2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate has a molecular weight of 215.29 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate is sourced from PubChem (CID 142740059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).