C11H21NO3 — CID 142740059
2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate (PubChem CID 142740059) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate.
| Compound Name | 2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 142740059 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 2-methoxyethyl 2,6-dimethylpiperidine-1-carboxylate |
| SMILES | COCCOC(=O)N1C(C)CCCC1C |
| InChI | InChI=1S/C11H21NO3/c1-9-5-4-6-10(2)12(9)11(13)15-8-7-14-3/h9-10H,4-8H2,1-3H3 |
| InChIKey | WEAMNROVCOIRJY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|