C12H24N2O — CID 104967122
(2S,6R)-N-tert-butyl-2,6-dimethylpiperidine-1-carboxamide (PubChem CID 104967122) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is (2S,6R)-N-tert-butyl-2,6-dimethylpiperidine-1-carboxamide.
| Compound Name | (2S,6R)-N-tert-butyl-2,6-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 104967122 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | (2S,6R)-N-tert-butyl-2,6-dimethylpiperidine-1-carboxamide |
| SMILES | C[C@@H]1CCC[C@H](C)N1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H24N2O/c1-9-7-6-8-10(2)14(9)11(15)13-12(3,4)5/h9-10H,6-8H2,1-5H3,(H,13,15)/t9-,10+ |
| InChIKey | LUKSPRBXFDCURG-AOOOYVTPSA-N |
| XLogP | 2.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |