C21H21N3O3 — CID 110678535
benzyl 3-[(3-cyanophenyl)carbamoyl]piperidine-1-carboxylate (PubChem CID 110678535) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is benzyl 3-[(3-cyanophenyl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | benzyl 3-[(3-cyanophenyl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110678535 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | benzyl 3-[(3-cyanophenyl)carbamoyl]piperidine-1-carboxylate |
| SMILES | N#Cc1cccc(NC(=O)C2CCCN(C(=O)OCc3ccccc3)C2)c1 |
| InChI | InChI=1S/C21H21N3O3/c22-13-17-8-4-10-19(12-17)23-20(25)18-9-5-11-24(14-18)21(26)27-15-16-6-2-1-3-7-16/h1-4,6-8,10,12,18H,5,9,11,14-15H2,(H,23,25) |
| InChIKey | LGXXHFVBJOFYKU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |