C11H12N4OS — CID 110678645
2-(2,4-dimethyl-1,3-thiazol-5-yl)-N-pyrimidin-2-ylacetamide (PubChem CID 110678645) has the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. Its IUPAC name is 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N-pyrimidin-2-ylacetamide.
| Compound Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N-pyrimidin-2-ylacetamide |
|---|---|
| PubChem CID | 110678645 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N-pyrimidin-2-ylacetamide |
| SMILES | Cc1nc(C)c(CC(=O)Nc2ncccn2)s1 |
| InChI | InChI=1S/C11H12N4OS/c1-7-9(17-8(2)14-7)6-10(16)15-11-12-4-3-5-13-11/h3-5H,6H2,1-2H3,(H,12,13,15,16) |
| InChIKey | RNSPGVIBRDHAMW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |