C10H10N4OS — CID 110679736
2-(4-methyl-1,3-thiazol-5-yl)-N-pyrimidin-2-ylacetamide (PubChem CID 110679736) has the molecular formula C10H10N4OS and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-5-yl)-N-pyrimidin-2-ylacetamide.
| Compound Name | 2-(4-methyl-1,3-thiazol-5-yl)-N-pyrimidin-2-ylacetamide |
|---|---|
| PubChem CID | 110679736 |
| Molecular Formula | C10H10N4OS |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-5-yl)-N-pyrimidin-2-ylacetamide |
| SMILES | Cc1ncsc1CC(=O)Nc1ncccn1 |
| InChI | InChI=1S/C10H10N4OS/c1-7-8(16-6-13-7)5-9(15)14-10-11-3-2-4-12-10/h2-4,6H,5H2,1H3,(H,11,12,14,15) |
| InChIKey | GVQSHQVTFPXHKM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |