C9H12N2OS — CID 110679572
N-cyclopropyl-2-(4-methyl-1,3-thiazol-5-yl)acetamide (PubChem CID 110679572) has the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. Its IUPAC name is N-cyclopropyl-2-(4-methyl-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-cyclopropyl-2-(4-methyl-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 110679572 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | N-cyclopropyl-2-(4-methyl-1,3-thiazol-5-yl)acetamide |
| SMILES | Cc1ncsc1CC(=O)NC1CC1 |
| InChI | InChI=1S/C9H12N2OS/c1-6-8(13-5-10-6)4-9(12)11-7-2-3-7/h5,7H,2-4H2,1H3,(H,11,12) |
| InChIKey | UTYJDLTUPANENS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |