About 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methyl-4-phenyl-1,2-oxazol-5-one
3-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methyl-4-phenyl-1,2-oxazol-5-one (PubChem CID 110680888) has the molecular formula C20H18N2O3
and a molecular weight of 334.38 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methyl-4-phenyl-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methyl-4-phenyl-1,2-oxazol-5-one |
| PubChem CID | 110680888 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methyl-4-phenyl-1,2-oxazol-5-one |
| SMILES | Cn1oc(=O)c(-c2ccccc2)c1C(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C20H18N2O3/c1-21-18(17(20(24)25-21)15-9-3-2-4-10-15)19(23)22-13-7-11-14-8-5-6-12-16(14)22/h2-6,8-10,12H,7,11,13H2,1H3 |
| InChIKey | UHMPTZXFDBHXOD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methyl-4-phenyl-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methyl-4-phenyl-1,2-oxazol-5-one?
The IUPAC name of 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methyl-4-phenyl-1,2-oxazol-5-one (CID 110680888) is 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methyl-4-phenyl-1,2-oxazol-5-one.
What is the SMILES notation for 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methyl-4-phenyl-1,2-oxazol-5-one?
The canonical SMILES for 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methyl-4-phenyl-1,2-oxazol-5-one is Cn1oc(=O)c(-c2ccccc2)c1C(=O)N1CCCc2ccccc21.
What is the InChIKey of 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methyl-4-phenyl-1,2-oxazol-5-one?
The InChIKey is UHMPTZXFDBHXOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O3/c1-21-18(17(20(24)25-21)15-9-3-2-4-10-15)19(23)22-13-7-11-14-8-5-6-12-16(14)22/h2-6,8-10,12H,7,11,13H2,1H3.
What are the key properties of 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methyl-4-phenyl-1,2-oxazol-5-one?
3-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methyl-4-phenyl-1,2-oxazol-5-one has a molecular weight of 334.38 g/mol, XLogP of 3.24, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methyl-4-phenyl-1,2-oxazol-5-one is sourced from PubChem (CID 110680888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).