C15H26N2O3S — CID 110687823
N-[2-(cyclohexen-1-yl)ethyl]-3-(1,1-dioxothiazinan-2-yl)propanamide (PubChem CID 110687823) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-(1,1-dioxothiazinan-2-yl)propanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-(1,1-dioxothiazinan-2-yl)propanamide |
|---|---|
| PubChem CID | 110687823 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-(1,1-dioxothiazinan-2-yl)propanamide |
| SMILES | O=C(CCN1CCCCS1(=O)=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C15H26N2O3S/c18-15(16-10-8-14-6-2-1-3-7-14)9-12-17-11-4-5-13-21(17,19)20/h6H,1-5,7-13H2,(H,16,18) |
| InChIKey | YVGFZQSKRCRQAK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|