C14H22N2O — CID 110688696
1-(2,6-dimethylpiperidin-1-yl)-3-pyrrol-1-ylpropan-1-one (PubChem CID 110688696) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-(2,6-dimethylpiperidin-1-yl)-3-pyrrol-1-ylpropan-1-one.
| Compound Name | 1-(2,6-dimethylpiperidin-1-yl)-3-pyrrol-1-ylpropan-1-one |
|---|---|
| PubChem CID | 110688696 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 1-(2,6-dimethylpiperidin-1-yl)-3-pyrrol-1-ylpropan-1-one |
| SMILES | CC1CCCC(C)N1C(=O)CCn1cccc1 |
| InChI | InChI=1S/C14H22N2O/c1-12-6-5-7-13(2)16(12)14(17)8-11-15-9-3-4-10-15/h3-4,9-10,12-13H,5-8,11H2,1-2H3 |
| InChIKey | DIXWVETWDYVUSC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |