C16H21N3O3 — CID 110689081
4-(4-ethylpiperazine-1-carbonyl)-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 110689081) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 4-(4-ethylpiperazine-1-carbonyl)-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | 4-(4-ethylpiperazine-1-carbonyl)-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 110689081 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 4-(4-ethylpiperazine-1-carbonyl)-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | CCN1CCN(C(=O)C2NC(=O)OC2c2ccccc2)CC1 |
| InChI | InChI=1S/C16H21N3O3/c1-2-18-8-10-19(11-9-18)15(20)13-14(22-16(21)17-13)12-6-4-3-5-7-12/h3-7,13-14H,2,8-11H2,1H3,(H,17,21) |
| InChIKey | VTKSSZWESRXPAM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |