C19H18N2O3 — CID 110689141
4-(3,4-dihydro-2H-quinoline-1-carbonyl)-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 110689141) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-quinoline-1-carbonyl)-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | 4-(3,4-dihydro-2H-quinoline-1-carbonyl)-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 110689141 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 4-(3,4-dihydro-2H-quinoline-1-carbonyl)-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(C(=O)N2CCCc3ccccc32)C(c2ccccc2)O1 |
| InChI | InChI=1S/C19H18N2O3/c22-18(21-12-6-10-13-7-4-5-11-15(13)21)16-17(24-19(23)20-16)14-8-2-1-3-9-14/h1-5,7-9,11,16-17H,6,10,12H2,(H,20,23) |
| InChIKey | GNJWLDUNAZJHTG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |