C19H30O6Si — CID 11068989
(3R,3aR,7aS)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3a-hydroxy-7a-trimethylsilyloxy-4,7-dihydro-3H-2-benzofuran-1-one (PubChem CID 11068989) has the molecular formula C19H30O6Si and a molecular weight of 382.53 g/mol. Its IUPAC name is (3R,3aR,7aS)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3a-hydroxy-7a-trimethylsilyloxy-4,7-dihydro-3H-2-benzofuran-1-one.
| Compound Name | (3R,3aR,7aS)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3a-hydroxy-7a-trimethylsilyloxy-4,7-dihydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 11068989 |
| Molecular Formula | C19H30O6Si |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (3R,3aR,7aS)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3a-hydroxy-7a-trimethylsilyloxy-4,7-dihydro-3H-2-benzofuran-1-one |
| SMILES | C[Si](C)(C)O[C@@]12CC=CC[C@@]1(O)[C@@H]([C@@H]1COC3(CCCCC3)O1)OC2=O |
| InChI | InChI=1S/C19H30O6Si/c1-26(2,3)25-19-12-8-7-11-18(19,21)15(23-16(19)20)14-13-22-17(24-14)9-5-4-6-10-17/h7-8,14-15,21H,4-6,9-13H2,1-3H3/t14-,15+,18+,19+/m0/s1 |
| InChIKey | OWZYKFYRFZXXRB-OSGQAZFXSA-N |
| XLogP | 2.66 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|