C16H22O6 — CID 101161073
(3R,3aR,7aS)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3a,7a-dihydroxy-4,7-dihydro-3H-2-benzofuran-1-one (PubChem CID 101161073) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is (3R,3aR,7aS)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3a,7a-dihydroxy-4,7-dihydro-3H-2-benzofuran-1-one.
| Compound Name | (3R,3aR,7aS)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3a,7a-dihydroxy-4,7-dihydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 101161073 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (3R,3aR,7aS)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3a,7a-dihydroxy-4,7-dihydro-3H-2-benzofuran-1-one |
| SMILES | O=C1O[C@H]([C@@H]2COC3(CCCCC3)O2)[C@]2(O)CC=CC[C@@]12O |
| InChI | InChI=1S/C16H22O6/c17-13-16(19)9-5-4-8-15(16,18)12(21-13)11-10-20-14(22-11)6-2-1-3-7-14/h4-5,11-12,18-19H,1-3,6-10H2/t11-,12+,15+,16+/m0/s1 |
| InChIKey | MKFOSNRIBQASIU-UAXWRAGISA-N |
| XLogP | 0.80 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|