C12H18O6 — CID 11253909
(3S,4S,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy-3-prop-2-enyloxolan-2-one (PubChem CID 11253909) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is (3S,4S,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy-3-prop-2-enyloxolan-2-one.
| Compound Name | (3S,4S,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy-3-prop-2-enyloxolan-2-one |
|---|---|
| PubChem CID | 11253909 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (3S,4S,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy-3-prop-2-enyloxolan-2-one |
| SMILES | C=CC[C@@]1(O)C(=O)O[C@H]([C@@H]2COC(C)(C)O2)[C@@H]1O |
| InChI | InChI=1S/C12H18O6/c1-4-5-12(15)9(13)8(17-10(12)14)7-6-16-11(2,3)18-7/h4,7-9,13,15H,1,5-6H2,2-3H3/t7-,8+,9-,12-/m0/s1 |
| InChIKey | DJNPYMFEVQZWCL-NHRVJRKFSA-N |
| XLogP | -0.27 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|