C13H22O7 — CID 54096678
methyl (2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-prop-2-enoxy-2-prop-2-enylhexanoate (PubChem CID 54096678) has the molecular formula C13H22O7 and a molecular weight of 290.31 g/mol. Its IUPAC name is methyl (2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-prop-2-enoxy-2-prop-2-enylhexanoate.
| Compound Name | methyl (2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-prop-2-enoxy-2-prop-2-enylhexanoate |
|---|---|
| PubChem CID | 54096678 |
| Molecular Formula | C13H22O7 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | methyl (2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-prop-2-enoxy-2-prop-2-enylhexanoate |
| SMILES | C=CCO[C@@](CC=C)(C(=O)OC)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H22O7/c1-4-6-13(12(18)19-3,20-7-5-2)11(17)10(16)9(15)8-14/h4-5,9-11,14-17H,1-2,6-8H2,3H3/t9-,10-,11+,13-/m1/s1 |
| InChIKey | MXPFDZLWEHACKS-HNCHTBHHSA-N |
| XLogP | -1.25 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|