C13H22O7 — CID 22806449
(2R,3S)-3-hydroxy-2-methyl-2-prop-2-enoxy-3-[(1R,2R)-1,2,3-trihydroxypropyl]hex-5-enoic acid (PubChem CID 22806449) has the molecular formula C13H22O7 and a molecular weight of 290.31 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-2-methyl-2-prop-2-enoxy-3-[(1R,2R)-1,2,3-trihydroxypropyl]hex-5-enoic acid.
| Compound Name | (2R,3S)-3-hydroxy-2-methyl-2-prop-2-enoxy-3-[(1R,2R)-1,2,3-trihydroxypropyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 22806449 |
| Molecular Formula | C13H22O7 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (2R,3S)-3-hydroxy-2-methyl-2-prop-2-enoxy-3-[(1R,2R)-1,2,3-trihydroxypropyl]hex-5-enoic acid |
| SMILES | C=CCO[C@@](C)(C(=O)O)[C@](O)(CC=C)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H22O7/c1-4-6-13(19,10(16)9(15)8-14)12(3,11(17)18)20-7-5-2/h4-5,9-10,14-16,19H,1-2,6-8H2,3H3,(H,17,18)/t9-,10-,12+,13+/m1/s1 |
| InChIKey | FCLIKCBEUBSNNO-AAXDQBDMSA-N |
| XLogP | -0.95 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|