C9H16O7 — CID 91347446
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-prop-2-enylhexanoic acid (PubChem CID 91347446) has the molecular formula C9H16O7 and a molecular weight of 236.22 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-prop-2-enylhexanoic acid.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-prop-2-enylhexanoic acid |
|---|---|
| PubChem CID | 91347446 |
| Molecular Formula | C9H16O7 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-prop-2-enylhexanoic acid |
| SMILES | C=CC[C@](O)(C(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H16O7/c1-2-3-9(16,8(14)15)7(13)6(12)5(11)4-10/h2,5-7,10-13,16H,1,3-4H2,(H,14,15)/t5-,6-,7+,9-/m1/s1 |
| InChIKey | GLFFRFBMTOHNBL-JAGXHNFQSA-N |
| XLogP | -2.55 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|