C12H22O9 — CID 91013418
(2R,3R,4S,6R,7R,8R)-2,3,4,6,7,8,9-heptahydroxy-2-prop-2-enylnonanoic acid (PubChem CID 91013418) has the molecular formula C12H22O9 and a molecular weight of 310.30 g/mol. Its IUPAC name is (2R,3R,4S,6R,7R,8R)-2,3,4,6,7,8,9-heptahydroxy-2-prop-2-enylnonanoic acid.
| Compound Name | (2R,3R,4S,6R,7R,8R)-2,3,4,6,7,8,9-heptahydroxy-2-prop-2-enylnonanoic acid |
|---|---|
| PubChem CID | 91013418 |
| Molecular Formula | C12H22O9 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | (2R,3R,4S,6R,7R,8R)-2,3,4,6,7,8,9-heptahydroxy-2-prop-2-enylnonanoic acid |
| SMILES | C=CC[C@](O)(C(=O)O)[C@H](O)[C@@H](O)C[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H22O9/c1-2-3-12(21,11(19)20)10(18)7(15)4-6(14)9(17)8(16)5-13/h2,6-10,13-18,21H,1,3-5H2,(H,19,20)/t6-,7+,8-,9-,10-,12-/m1/s1 |
| InChIKey | MEKYEPIGKITPBU-BVTIPKRDSA-N |
| XLogP | -3.43 |
| TPSA | 178.91 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|