C21H34O6Si — CID 10894865
(3S,4R,5R)-5-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-4-hydroxy-3,4-bis(prop-2-enyl)-3-trimethylsilyloxyoxolan-2-one (PubChem CID 10894865) has the molecular formula C21H34O6Si and a molecular weight of 410.58 g/mol. Its IUPAC name is (3S,4R,5R)-5-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-4-hydroxy-3,4-bis(prop-2-enyl)-3-trimethylsilyloxyoxolan-2-one.
| Compound Name | (3S,4R,5R)-5-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-4-hydroxy-3,4-bis(prop-2-enyl)-3-trimethylsilyloxyoxolan-2-one |
|---|---|
| PubChem CID | 10894865 |
| Molecular Formula | C21H34O6Si |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (3S,4R,5R)-5-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-4-hydroxy-3,4-bis(prop-2-enyl)-3-trimethylsilyloxyoxolan-2-one |
| SMILES | C=CC[C@@]1(O)[C@@H]([C@@H]2COC3(CCCCC3)O2)OC(=O)[C@@]1(CC=C)O[Si](C)(C)C |
| InChI | InChI=1S/C21H34O6Si/c1-6-11-20(23)17(16-15-24-19(26-16)13-9-8-10-14-19)25-18(22)21(20,12-7-2)27-28(3,4)5/h6-7,16-17,23H,1-2,8-15H2,3-5H3/t16-,17+,20+,21+/m0/s1 |
| InChIKey | XWDLJQVYVNWCCW-XWDORNJCSA-N |
| XLogP | 3.46 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|