C20H21N3O5 — CID 11069005
tert-butyl 2-[3-(4-nitrophenyl)-2-oxo-1,4-dihydroquinazolin-4-yl]acetate (PubChem CID 11069005) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is tert-butyl 2-[3-(4-nitrophenyl)-2-oxo-1,4-dihydroquinazolin-4-yl]acetate.
| Compound Name | tert-butyl 2-[3-(4-nitrophenyl)-2-oxo-1,4-dihydroquinazolin-4-yl]acetate |
|---|---|
| PubChem CID | 11069005 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | tert-butyl 2-[3-(4-nitrophenyl)-2-oxo-1,4-dihydroquinazolin-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1c2ccccc2NC(=O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H21N3O5/c1-20(2,3)28-18(24)12-17-15-6-4-5-7-16(15)21-19(25)22(17)13-8-10-14(11-9-13)23(26)27/h4-11,17H,12H2,1-3H3,(H,21,25) |
| InChIKey | XNWBMHKIAXFMQQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|