C20H28N2O3 — CID 15880525
tert-butyl 2-(3-cyclohexyl-2-oxo-1,4-dihydroquinazolin-4-yl)acetate (PubChem CID 15880525) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is tert-butyl 2-(3-cyclohexyl-2-oxo-1,4-dihydroquinazolin-4-yl)acetate.
| Compound Name | tert-butyl 2-(3-cyclohexyl-2-oxo-1,4-dihydroquinazolin-4-yl)acetate |
|---|---|
| PubChem CID | 15880525 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | tert-butyl 2-(3-cyclohexyl-2-oxo-1,4-dihydroquinazolin-4-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CC1c2ccccc2NC(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C20H28N2O3/c1-20(2,3)25-18(23)13-17-15-11-7-8-12-16(15)21-19(24)22(17)14-9-5-4-6-10-14/h7-8,11-12,14,17H,4-6,9-10,13H2,1-3H3,(H,21,24) |
| InChIKey | JORYCZGOWCQXBZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |