C14H20N2O3 — CID 110690844
ethyl 1-[2-(1H-pyrrol-2-yl)acetyl]piperidine-3-carboxylate (PubChem CID 110690844) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is ethyl 1-[2-(1H-pyrrol-2-yl)acetyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-(1H-pyrrol-2-yl)acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110690844 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | ethyl 1-[2-(1H-pyrrol-2-yl)acetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)Cc2ccc[nH]2)C1 |
| InChI | InChI=1S/C14H20N2O3/c1-2-19-14(18)11-5-4-8-16(10-11)13(17)9-12-6-3-7-15-12/h3,6-7,11,15H,2,4-5,8-10H2,1H3 |
| InChIKey | PENTYMOHJRFJEO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |