C18H22N2O3 — CID 84577392
ethyl 1-[2-(1H-indol-6-yl)acetyl]piperidine-3-carboxylate (PubChem CID 84577392) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is ethyl 1-[2-(1H-indol-6-yl)acetyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-(1H-indol-6-yl)acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 84577392 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | ethyl 1-[2-(1H-indol-6-yl)acetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)Cc2ccc3cc[nH]c3c2)C1 |
| InChI | InChI=1S/C18H22N2O3/c1-2-23-18(22)15-4-3-9-20(12-15)17(21)11-13-5-6-14-7-8-19-16(14)10-13/h5-8,10,15,19H,2-4,9,11-12H2,1H3 |
| InChIKey | LRGFZDITXRBDLW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |