C22H22FN3O3 — CID 96524544
1H-indazol-6-ylmethyl (3R)-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carboxylate (PubChem CID 96524544) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is 1H-indazol-6-ylmethyl (3R)-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carboxylate.
| Compound Name | 1H-indazol-6-ylmethyl (3R)-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 96524544 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 1H-indazol-6-ylmethyl (3R)-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carboxylate |
| SMILES | O=C(OCc1ccc2cn[nH]c2c1)[C@@H]1CCCN(C(=O)Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H22FN3O3/c23-19-7-4-15(5-8-19)11-21(27)26-9-1-2-18(13-26)22(28)29-14-16-3-6-17-12-24-25-20(17)10-16/h3-8,10,12,18H,1-2,9,11,13-14H2,(H,24,25)/t18-/m1/s1 |
| InChIKey | NLGXWUDVPRAWEK-GOSISDBHSA-N |
| XLogP | 3.23 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |