C11H10Cl2N2O2S — CID 110695618
N-(2,6-dichlorophenyl)-5-oxothiomorpholine-3-carboxamide (PubChem CID 110695618) has the molecular formula C11H10Cl2N2O2S and a molecular weight of 305.19 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-5-oxothiomorpholine-3-carboxamide.
| Compound Name | N-(2,6-dichlorophenyl)-5-oxothiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 110695618 |
| Molecular Formula | C11H10Cl2N2O2S |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | N-(2,6-dichlorophenyl)-5-oxothiomorpholine-3-carboxamide |
| SMILES | O=C1CSCC(C(=O)Nc2c(Cl)cccc2Cl)N1 |
| InChI | InChI=1S/C11H10Cl2N2O2S/c12-6-2-1-3-7(13)10(6)15-11(17)8-4-18-5-9(16)14-8/h1-3,8H,4-5H2,(H,14,16)(H,15,17) |
| InChIKey | ITBKUMLLGCGPJA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |