C24H40O5 — CID 11069572
(1S,2S,6R,8R)-9-(methoxymethoxy)-2-methyl-2-[4-(oxan-2-yloxy)butyl]tricyclo[6.3.1.01,6]dodecan-4-one (PubChem CID 11069572) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is (1S,2S,6R,8R)-9-(methoxymethoxy)-2-methyl-2-[4-(oxan-2-yloxy)butyl]tricyclo[6.3.1.01,6]dodecan-4-one.
| Compound Name | (1S,2S,6R,8R)-9-(methoxymethoxy)-2-methyl-2-[4-(oxan-2-yloxy)butyl]tricyclo[6.3.1.01,6]dodecan-4-one |
|---|---|
| PubChem CID | 11069572 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | (1S,2S,6R,8R)-9-(methoxymethoxy)-2-methyl-2-[4-(oxan-2-yloxy)butyl]tricyclo[6.3.1.01,6]dodecan-4-one |
| SMILES | COCOC1CC[C@]23C[C@H]1C[C@@H]2CC(=O)C[C@]3(C)CCCCOC1CCCCO1 |
| InChI | InChI=1S/C24H40O5/c1-23(9-4-6-12-28-22-7-3-5-11-27-22)16-20(25)14-19-13-18-15-24(19,23)10-8-21(18)29-17-26-2/h18-19,21-22H,3-17H2,1-2H3/t18-,19-,21?,22?,23+,24+/m1/s1 |
| InChIKey | OJBIWEPCONJJOU-LLTRDYRJSA-N |
| XLogP | 4.86 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|