C11H18N2O — CID 110695748
2-methyl-N-(3-methylbutyl)-1H-pyrrole-3-carboxamide (PubChem CID 110695748) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-methyl-N-(3-methylbutyl)-1H-pyrrole-3-carboxamide.
| Compound Name | 2-methyl-N-(3-methylbutyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 110695748 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-methyl-N-(3-methylbutyl)-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]ccc1C(=O)NCCC(C)C |
| InChI | InChI=1S/C11H18N2O/c1-8(2)4-6-13-11(14)10-5-7-12-9(10)3/h5,7-8,12H,4,6H2,1-3H3,(H,13,14) |
| InChIKey | UQZDHVFUJZXQNA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |