C8H9N3O — CID 130645768
N-(cyanomethyl)-2-methyl-1H-pyrrole-3-carboxamide (PubChem CID 130645768) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is N-(cyanomethyl)-2-methyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-(cyanomethyl)-2-methyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 130645768 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | N-(cyanomethyl)-2-methyl-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]ccc1C(=O)NCC#N |
| InChI | InChI=1S/C8H9N3O/c1-6-7(2-4-10-6)8(12)11-5-3-9/h2,4,10H,5H2,1H3,(H,11,12) |
| InChIKey | PLOXKQJWBXBQNV-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|