C14H15N3O2S — CID 110696392
N-(4-acetamidophenyl)-4,5-dimethyl-1,3-thiazole-2-carboxamide (PubChem CID 110696392) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-4,5-dimethyl-1,3-thiazole-2-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-4,5-dimethyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 110696392 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-(4-acetamidophenyl)-4,5-dimethyl-1,3-thiazole-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2nc(C)c(C)s2)cc1 |
| InChI | InChI=1S/C14H15N3O2S/c1-8-9(2)20-14(15-8)13(19)17-12-6-4-11(5-7-12)16-10(3)18/h4-7H,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | ILGDLHIWNREIMD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |