About 4,5-dimethyl-1,3-thiazole-2-carboxamide
4,5-dimethyl-1,3-thiazole-2-carboxamide (PubChem CID 22382631) has the molecular formula C6H8N2OS
and a molecular weight of 156.21 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 4,5-dimethyl-1,3-thiazole-2-carboxamide |
| PubChem CID | 22382631 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 4,5-dimethyl-1,3-thiazole-2-carboxamide |
| SMILES | Cc1nc(C(N)=O)sc1C |
| InChI | InChI=1S/C6H8N2OS/c1-3-4(2)10-6(8-3)5(7)9/h1-2H3,(H2,7,9) |
| InChIKey | YMGLMTLHIHIXNO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dimethyl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-1,3-thiazole-2-carboxamide?
The IUPAC name of 4,5-dimethyl-1,3-thiazole-2-carboxamide (CID 22382631) is 4,5-dimethyl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 4,5-dimethyl-1,3-thiazole-2-carboxamide?
The canonical SMILES for 4,5-dimethyl-1,3-thiazole-2-carboxamide is Cc1nc(C(N)=O)sc1C.
What is the InChIKey of 4,5-dimethyl-1,3-thiazole-2-carboxamide?
The InChIKey is YMGLMTLHIHIXNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS/c1-3-4(2)10-6(8-3)5(7)9/h1-2H3,(H2,7,9).
What are the key properties of 4,5-dimethyl-1,3-thiazole-2-carboxamide?
4,5-dimethyl-1,3-thiazole-2-carboxamide has a molecular weight of 156.21 g/mol, XLogP of 0.86, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 22382631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).