C6H8N2OS — CID 22382631
4,5-dimethyl-1,3-thiazole-2-carboxamide (PubChem CID 22382631) has the molecular formula C6H8N2OS and a molecular weight of 156.21 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-thiazole-2-carboxamide.
| Compound Name | 4,5-dimethyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 22382631 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 4,5-dimethyl-1,3-thiazole-2-carboxamide |
| SMILES | Cc1nc(C(N)=O)sc1C |
| InChI | InChI=1S/C6H8N2OS/c1-3-4(2)10-6(8-3)5(7)9/h1-2H3,(H2,7,9) |
| InChIKey | YMGLMTLHIHIXNO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |