C26H24O5 — CID 11069746
5-O-benzyl 1-O-methyl (2E,4S)-2-(phenoxymethylidene)-4-phenylpentanedioate (PubChem CID 11069746) has the molecular formula C26H24O5 and a molecular weight of 416.47 g/mol. Its IUPAC name is 5-O-benzyl 1-O-methyl (2E,4S)-2-(phenoxymethylidene)-4-phenylpentanedioate.
| Compound Name | 5-O-benzyl 1-O-methyl (2E,4S)-2-(phenoxymethylidene)-4-phenylpentanedioate |
|---|---|
| PubChem CID | 11069746 |
| Molecular Formula | C26H24O5 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 5-O-benzyl 1-O-methyl (2E,4S)-2-(phenoxymethylidene)-4-phenylpentanedioate |
| SMILES | COC(=O)/C(=C/Oc1ccccc1)C[C@H](C(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24O5/c1-29-25(27)22(19-30-23-15-9-4-10-16-23)17-24(21-13-7-3-8-14-21)26(28)31-18-20-11-5-2-6-12-20/h2-16,19,24H,17-18H2,1H3/b22-19+/t24-/m0/s1 |
| InChIKey | FYDIBZJPXOZBOH-FABAWLPWSA-N |
| XLogP | 5.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|