C15H18N4O3S — CID 110702370
N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-phenyltriazole-4-carboxamide (PubChem CID 110702370) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-phenyltriazole-4-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 110702370 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-phenyltriazole-4-carboxamide |
| SMILES | CCN(C(=O)c1cnn(-c2ccccc2)n1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18N4O3S/c1-2-18(13-8-9-23(21,22)11-13)15(20)14-10-16-19(17-14)12-6-4-3-5-7-12/h3-7,10,13H,2,8-9,11H2,1H3 |
| InChIKey | LOTNOBOQDKJAJR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |