C16H19N3O3S — CID 134012568
N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-phenylpyrazole-4-carboxamide (PubChem CID 134012568) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 134012568 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-phenylpyrazole-4-carboxamide |
| SMILES | CCN(C(=O)c1cnn(-c2ccccc2)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H19N3O3S/c1-2-18(15-8-9-23(21,22)12-15)16(20)13-10-17-19(11-13)14-6-4-3-5-7-14/h3-7,10-11,15H,2,8-9,12H2,1H3 |
| InChIKey | IOHPXORKQDTFBD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |