C14H17N3O3 — CID 110703727
N-(3,5-dimethylphenyl)-3-(3,5-dioxopyrazolidin-4-yl)propanamide (PubChem CID 110703727) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-3-(3,5-dioxopyrazolidin-4-yl)propanamide.
| Compound Name | N-(3,5-dimethylphenyl)-3-(3,5-dioxopyrazolidin-4-yl)propanamide |
|---|---|
| PubChem CID | 110703727 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(3,5-dimethylphenyl)-3-(3,5-dioxopyrazolidin-4-yl)propanamide |
| SMILES | Cc1cc(C)cc(NC(=O)CCC2C(=O)NNC2=O)c1 |
| InChI | InChI=1S/C14H17N3O3/c1-8-5-9(2)7-10(6-8)15-12(18)4-3-11-13(19)16-17-14(11)20/h5-7,11H,3-4H2,1-2H3,(H,15,18)(H,16,19)(H,17,20) |
| InChIKey | CQVNAEFPZZCFEZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|