C21H31BrN2O2Si — CID 11070414
tert-butyl 4-(2-bromoanilino)-4-(2-trimethylsilylethynyl)piperidine-1-carboxylate (PubChem CID 11070414) has the molecular formula C21H31BrN2O2Si and a molecular weight of 451.48 g/mol. Its IUPAC name is tert-butyl 4-(2-bromoanilino)-4-(2-trimethylsilylethynyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-bromoanilino)-4-(2-trimethylsilylethynyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11070414 |
| Molecular Formula | C21H31BrN2O2Si |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | tert-butyl 4-(2-bromoanilino)-4-(2-trimethylsilylethynyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C#C[Si](C)(C)C)(Nc2ccccc2Br)CC1 |
| InChI | InChI=1S/C21H31BrN2O2Si/c1-20(2,3)26-19(25)24-14-11-21(12-15-24,13-16-27(4,5)6)23-18-10-8-7-9-17(18)22/h7-10,23H,11-12,14-15H2,1-6H3 |
| InChIKey | PADXVGQKPKPXJR-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|