C18H23BrN2O2 — CID 15850389
tert-butyl 4-(2-bromoanilino)-4-ethynylpiperidine-1-carboxylate (PubChem CID 15850389) has the molecular formula C18H23BrN2O2 and a molecular weight of 379.30 g/mol. Its IUPAC name is tert-butyl 4-(2-bromoanilino)-4-ethynylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-bromoanilino)-4-ethynylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 15850389 |
| Molecular Formula | C18H23BrN2O2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | tert-butyl 4-(2-bromoanilino)-4-ethynylpiperidine-1-carboxylate |
| SMILES | C#CC1(Nc2ccccc2Br)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H23BrN2O2/c1-5-18(20-15-9-7-6-8-14(15)19)10-12-21(13-11-18)16(22)23-17(2,3)4/h1,6-9,20H,10-13H2,2-4H3 |
| InChIKey | FFRAGLRJPMYCSN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|