C30H52Si2 — CID 11070688
[(E)-3,4-dicyclopropyl-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane (PubChem CID 11070688) has the molecular formula C30H52Si2 and a molecular weight of 468.92 g/mol. Its IUPAC name is [(E)-3,4-dicyclopropyl-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane.
| Compound Name | [(E)-3,4-dicyclopropyl-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11070688 |
| Molecular Formula | C30H52Si2 |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | [(E)-3,4-dicyclopropyl-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#C/C(=C(/C#C[Si](C(C)C)(C(C)C)C(C)C)C1CC1)C1CC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H52Si2/c1-21(2)31(22(3)4,23(5)6)19-17-29(27-13-14-27)30(28-15-16-28)18-20-32(24(7)8,25(9)10)26(11)12/h21-28H,13-16H2,1-12H3/b30-29+ |
| InChIKey | LILNHBUNJXXUTN-QVIHXGFCSA-N |
| XLogP | 9.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|